C17H25N5O — CID 19135400
4-N-(4-butoxyphenyl)-6-N-propylpyrimidine-4,5,6-triamine (PubChem CID 19135400) has the molecular formula C17H25N5O and a molecular weight of 315.42 g/mol. Its IUPAC name is 4-N-(4-butoxyphenyl)-6-N-propylpyrimidine-4,5,6-triamine.
| Compound Name | 4-N-(4-butoxyphenyl)-6-N-propylpyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 19135400 |
| Molecular Formula | C17H25N5O |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.21 |
| IUPAC Name | 4-N-(4-butoxyphenyl)-6-N-propylpyrimidine-4,5,6-triamine |
| SMILES | CCCCOc1ccc(Nc2ncnc(NCCC)c2N)cc1 |
| InChI | InChI=1S/C17H25N5O/c1-3-5-11-23-14-8-6-13(7-9-14)22-17-15(18)16(19-10-4-2)20-12-21-17/h6-9,12H,3-5,10-11,18H2,1-2H3,(H2,19,20,21,22) |
| InChIKey | JYLKQRBBASTPSH-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|