C22H27N5O — CID 19142974
6-N-(4-butoxyphenyl)-4-N-(2,4-dimethylphenyl)pyrimidine-4,5,6-triamine (PubChem CID 19142974) has the molecular formula C22H27N5O and a molecular weight of 377.49 g/mol. Its IUPAC name is 6-N-(4-butoxyphenyl)-4-N-(2,4-dimethylphenyl)pyrimidine-4,5,6-triamine.
| Compound Name | 6-N-(4-butoxyphenyl)-4-N-(2,4-dimethylphenyl)pyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 19142974 |
| Molecular Formula | C22H27N5O |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | 6-N-(4-butoxyphenyl)-4-N-(2,4-dimethylphenyl)pyrimidine-4,5,6-triamine |
| SMILES | CCCCOc1ccc(Nc2ncnc(Nc3ccc(C)cc3C)c2N)cc1 |
| InChI | InChI=1S/C22H27N5O/c1-4-5-12-28-18-9-7-17(8-10-18)26-21-20(23)22(25-14-24-21)27-19-11-6-15(2)13-16(19)3/h6-11,13-14H,4-5,12,23H2,1-3H3,(H2,24,25,26,27) |
| InChIKey | SGJJDQJFOGCBLL-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|