C22H25ClN4O2 — CID 19143073
4-N-(4-butoxyphenyl)-6-(4-chloro-3,5-dimethylphenoxy)pyrimidine-4,5-diamine (PubChem CID 19143073) has the molecular formula C22H25ClN4O2 and a molecular weight of 412.92 g/mol. Its IUPAC name is 4-N-(4-butoxyphenyl)-6-(4-chloro-3,5-dimethylphenoxy)pyrimidine-4,5-diamine.
| Compound Name | 4-N-(4-butoxyphenyl)-6-(4-chloro-3,5-dimethylphenoxy)pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 19143073 |
| Molecular Formula | C22H25ClN4O2 |
| Molecular Weight | 412.92 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | 4-N-(4-butoxyphenyl)-6-(4-chloro-3,5-dimethylphenoxy)pyrimidine-4,5-diamine |
| SMILES | CCCCOc1ccc(Nc2ncnc(Oc3cc(C)c(Cl)c(C)c3)c2N)cc1 |
| InChI | InChI=1S/C22H25ClN4O2/c1-4-5-10-28-17-8-6-16(7-9-17)27-21-20(24)22(26-13-25-21)29-18-11-14(2)19(23)15(3)12-18/h6-9,11-13H,4-5,10,24H2,1-3H3,(H,25,26,27) |
| InChIKey | QUXWVPITJAQQKB-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.92 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|