C18H17IN4O — CID 19148973
6-(3,4-dimethylphenoxy)-4-N-(4-iodophenyl)pyrimidine-4,5-diamine (PubChem CID 19148973) has the molecular formula C18H17IN4O and a molecular weight of 432.27 g/mol. Its IUPAC name is 6-(3,4-dimethylphenoxy)-4-N-(4-iodophenyl)pyrimidine-4,5-diamine.
| Compound Name | 6-(3,4-dimethylphenoxy)-4-N-(4-iodophenyl)pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 19148973 |
| Molecular Formula | C18H17IN4O |
| Molecular Weight | 432.27 g/mol |
| Exact Mass | 432.04 |
| IUPAC Name | 6-(3,4-dimethylphenoxy)-4-N-(4-iodophenyl)pyrimidine-4,5-diamine |
| SMILES | Cc1ccc(Oc2ncnc(Nc3ccc(I)cc3)c2N)cc1C |
| InChI | InChI=1S/C18H17IN4O/c1-11-3-8-15(9-12(11)2)24-18-16(20)17(21-10-22-18)23-14-6-4-13(19)5-7-14/h3-10H,20H2,1-2H3,(H,21,22,23) |
| InChIKey | WVODPTSVWATCEA-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.27 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|