C20H22N4O2 — CID 19143062
4-N-(4-butoxyphenyl)-6-phenoxypyrimidine-4,5-diamine (PubChem CID 19143062) has the molecular formula C20H22N4O2 and a molecular weight of 350.42 g/mol. Its IUPAC name is 4-N-(4-butoxyphenyl)-6-phenoxypyrimidine-4,5-diamine.
| Compound Name | 4-N-(4-butoxyphenyl)-6-phenoxypyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 19143062 |
| Molecular Formula | C20H22N4O2 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | 4-N-(4-butoxyphenyl)-6-phenoxypyrimidine-4,5-diamine |
| SMILES | CCCCOc1ccc(Nc2ncnc(Oc3ccccc3)c2N)cc1 |
| InChI | InChI=1S/C20H22N4O2/c1-2-3-13-25-16-11-9-15(10-12-16)24-19-18(21)20(23-14-22-19)26-17-7-5-4-6-8-17/h4-12,14H,2-3,13,21H2,1H3,(H,22,23,24) |
| InChIKey | JQFOLRFJBIPLHE-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|