C20H23N5O — CID 19154145
4-N-butan-2-yl-6-N-(4-phenoxyphenyl)pyrimidine-4,5,6-triamine (PubChem CID 19154145) has the molecular formula C20H23N5O and a molecular weight of 349.44 g/mol. Its IUPAC name is 4-N-butan-2-yl-6-N-(4-phenoxyphenyl)pyrimidine-4,5,6-triamine.
| Compound Name | 4-N-butan-2-yl-6-N-(4-phenoxyphenyl)pyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 19154145 |
| Molecular Formula | C20H23N5O |
| Molecular Weight | 349.44 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | 4-N-butan-2-yl-6-N-(4-phenoxyphenyl)pyrimidine-4,5,6-triamine |
| SMILES | CCC(C)Nc1ncnc(Nc2ccc(Oc3ccccc3)cc2)c1N |
| InChI | InChI=1S/C20H23N5O/c1-3-14(2)24-19-18(21)20(23-13-22-19)25-15-9-11-17(12-10-15)26-16-7-5-4-6-8-16/h4-14H,3,21H2,1-2H3,(H2,22,23,24,25) |
| InChIKey | ZJNFPIFCUXIKLI-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.44 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |