C21H24ClN5O2 — CID 22545988
6-N-(4-butoxyphenyl)-4-N-(5-chloro-2-methoxyphenyl)pyrimidine-4,5,6-triamine (PubChem CID 22545988) has the molecular formula C21H24ClN5O2 and a molecular weight of 413.91 g/mol. Its IUPAC name is 6-N-(4-butoxyphenyl)-4-N-(5-chloro-2-methoxyphenyl)pyrimidine-4,5,6-triamine.
| Compound Name | 6-N-(4-butoxyphenyl)-4-N-(5-chloro-2-methoxyphenyl)pyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 22545988 |
| Molecular Formula | C21H24ClN5O2 |
| Molecular Weight | 413.91 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | 6-N-(4-butoxyphenyl)-4-N-(5-chloro-2-methoxyphenyl)pyrimidine-4,5,6-triamine |
| SMILES | CCCCOc1ccc(Nc2ncnc(Nc3cc(Cl)ccc3OC)c2N)cc1 |
| InChI | InChI=1S/C21H24ClN5O2/c1-3-4-11-29-16-8-6-15(7-9-16)26-20-19(23)21(25-13-24-20)27-17-12-14(22)5-10-18(17)28-2/h5-10,12-13H,3-4,11,23H2,1-2H3,(H2,24,25,26,27) |
| InChIKey | ZKOFCBCIMTXSOW-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.91 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|