C19H19ClN6O2 — CID 22546092
N-[4-[[5-amino-6-(5-chloro-2-methoxyanilino)pyrimidin-4-yl]amino]phenyl]acetamide (PubChem CID 22546092) has the molecular formula C19H19ClN6O2 and a molecular weight of 398.85 g/mol. Its IUPAC name is N-[4-[[5-amino-6-(5-chloro-2-methoxyanilino)pyrimidin-4-yl]amino]phenyl]acetamide.
| Compound Name | N-[4-[[5-amino-6-(5-chloro-2-methoxyanilino)pyrimidin-4-yl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 22546092 |
| Molecular Formula | C19H19ClN6O2 |
| Molecular Weight | 398.85 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | N-[4-[[5-amino-6-(5-chloro-2-methoxyanilino)pyrimidin-4-yl]amino]phenyl]acetamide |
| SMILES | COc1ccc(Cl)cc1Nc1ncnc(Nc2ccc(NC(C)=O)cc2)c1N |
| InChI | InChI=1S/C19H19ClN6O2/c1-11(27)24-13-4-6-14(7-5-13)25-18-17(21)19(23-10-22-18)26-15-9-12(20)3-8-16(15)28-2/h3-10H,21H2,1-2H3,(H,24,27)(H2,22,23,25,26) |
| InChIKey | BBVBAVVMXUFFDN-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 114.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.85 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |