C24H22Cl2N4O6 — CID 172839336
N-[4-acetamido-2,5-bis(5-chloro-2-methoxyanilino)-3,6-dioxocyclohexa-1,4-dien-1-yl]acetamide (PubChem CID 172839336) has the molecular formula C24H22Cl2N4O6 and a molecular weight of 533.37 g/mol. Its IUPAC name is N-[4-acetamido-2,5-bis(5-chloro-2-methoxyanilino)-3,6-dioxocyclohexa-1,4-dien-1-yl]acetamide.
| Compound Name | N-[4-acetamido-2,5-bis(5-chloro-2-methoxyanilino)-3,6-dioxocyclohexa-1,4-dien-1-yl]acetamide |
|---|---|
| PubChem CID | 172839336 |
| Molecular Formula | C24H22Cl2N4O6 |
| Molecular Weight | 533.37 g/mol |
| Exact Mass | 532.09 |
| IUPAC Name | N-[4-acetamido-2,5-bis(5-chloro-2-methoxyanilino)-3,6-dioxocyclohexa-1,4-dien-1-yl]acetamide |
| SMILES | COc1ccc(Cl)cc1NC1=C(NC(C)=O)C(=O)C(Nc2cc(Cl)ccc2OC)=C(NC(C)=O)C1=O |
| InChI | InChI=1S/C24H22Cl2N4O6/c1-11(31)27-19-21(29-15-9-13(25)5-7-17(15)35-3)24(34)20(28-12(2)32)22(23(19)33)30-16-10-14(26)6-8-18(16)36-4/h5-10,29-30H,1-4H3,(H,27,31)(H,28,32) |
| InChIKey | WOVDONBLLSBKPQ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 134.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.37 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|