C9H11ClN2O5 — CID 175007834
(5-chloro-2-methoxyphenyl)hydrazine;oxalic acid (PubChem CID 175007834) has the molecular formula C9H11ClN2O5 and a molecular weight of 262.65 g/mol. Its IUPAC name is (5-chloro-2-methoxyphenyl)hydrazine;oxalic acid.
| Compound Name | (5-chloro-2-methoxyphenyl)hydrazine;oxalic acid |
|---|---|
| PubChem CID | 175007834 |
| Molecular Formula | C9H11ClN2O5 |
| Molecular Weight | 262.65 g/mol |
| Exact Mass | 262.04 |
| IUPAC Name | (5-chloro-2-methoxyphenyl)hydrazine;oxalic acid |
| SMILES | COc1ccc(Cl)cc1NN.O=C(O)C(=O)O |
| InChI | InChI=1S/C7H9ClN2O.C2H2O4/c1-11-7-3-2-5(8)4-6(7)10-9;3-1(4)2(5)6/h2-4,10H,9H2,1H3;(H,3,4)(H,5,6) |
| InChIKey | BYINVDRMXIBFAC-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.65 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|