(5-chloro-2-methoxyphenyl)hydrazine;oxalic acid

C9H11ClN2O5 — CID 175007834

IUPAC(5-chloro-2-methoxyphenyl)hydrazine;oxalic acid
SMILESCOc1ccc(Cl)cc1NN.O=C(O)C(=O)O
InChIInChI=1S/C7H9ClN2O.C2H2O4/c1-11-7-3-2-5(8)4-6(7)10-9;3-1(4)2(5)6/h2-4,10H,9H2,1H3;(H,3,4)(H,5,6)
InChIKeyBYINVDRMXIBFAC-UHFFFAOYSA-N
MW262.65 g/mol
LogP0.79
Rot. Bonds2

About (5-chloro-2-methoxyphenyl)hydrazine;oxalic acid

(5-chloro-2-methoxyphenyl)hydrazine;oxalic acid (PubChem CID 175007834) has the molecular formula C9H11ClN2O5 and a molecular weight of 262.65 g/mol. Its IUPAC name is (5-chloro-2-methoxyphenyl)hydrazine;oxalic acid.

Molecular Properties

Compound Name(5-chloro-2-methoxyphenyl)hydrazine;oxalic acid
PubChem CID175007834
Molecular FormulaC9H11ClN2O5
Molecular Weight262.65 g/mol
Exact Mass262.04
IUPAC Name(5-chloro-2-methoxyphenyl)hydrazine;oxalic acid
SMILESCOc1ccc(Cl)cc1NN.O=C(O)C(=O)O
InChIInChI=1S/C7H9ClN2O.C2H2O4/c1-11-7-3-2-5(8)4-6(7)10-9;3-1(4)2(5)6/h2-4,10H,9H2,1H3;(H,3,4)(H,5,6)
InChIKeyBYINVDRMXIBFAC-UHFFFAOYSA-N
XLogP0.79
TPSA121.88 Ų
H-Bond Donors4
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500262.65
LogP ≤ 50.79
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze (5-chloro-2-methoxyphenyl)hydrazine;oxalic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (5-chloro-2-methoxyphenyl)hydrazine;oxalic acid?
The IUPAC name of (5-chloro-2-methoxyphenyl)hydrazine;oxalic acid (CID 175007834) is (5-chloro-2-methoxyphenyl)hydrazine;oxalic acid.
What is the SMILES notation for (5-chloro-2-methoxyphenyl)hydrazine;oxalic acid?
The canonical SMILES for (5-chloro-2-methoxyphenyl)hydrazine;oxalic acid is COc1ccc(Cl)cc1NN.O=C(O)C(=O)O.
What is the InChIKey of (5-chloro-2-methoxyphenyl)hydrazine;oxalic acid?
The InChIKey is BYINVDRMXIBFAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9ClN2O.C2H2O4/c1-11-7-3-2-5(8)4-6(7)10-9;3-1(4)2(5)6/h2-4,10H,9H2,1H3;(H,3,4)(H,5,6).
What are the key properties of (5-chloro-2-methoxyphenyl)hydrazine;oxalic acid?
(5-chloro-2-methoxyphenyl)hydrazine;oxalic acid has a molecular weight of 262.65 g/mol, XLogP of 0.79, 2 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-chloro-2-methoxyphenyl)hydrazine;oxalic acid is sourced from PubChem (CID 175007834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).