C11H13ClN2O3 — CID 94271903
N'-(5-chloro-2-methoxyphenyl)butanediamide (PubChem CID 94271903) has the molecular formula C11H13ClN2O3 and a molecular weight of 256.69 g/mol. Its IUPAC name is N'-(5-chloro-2-methoxyphenyl)butanediamide.
| Compound Name | N'-(5-chloro-2-methoxyphenyl)butanediamide |
|---|---|
| PubChem CID | 94271903 |
| Molecular Formula | C11H13ClN2O3 |
| Molecular Weight | 256.69 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | N'-(5-chloro-2-methoxyphenyl)butanediamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)CCC(N)=O |
| InChI | InChI=1S/C11H13ClN2O3/c1-17-9-3-2-7(12)6-8(9)14-11(16)5-4-10(13)15/h2-3,6H,4-5H2,1H3,(H2,13,15)(H,14,16) |
| InChIKey | PTOVEIPDHXZZBM-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.69 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |