C11H16BrClN4O2 — CID 131958555
N-(5-chloro-2-methoxyphenyl)-3-(diaminomethylideneamino)propanamide;hydrobromide (PubChem CID 131958555) has the molecular formula C11H16BrClN4O2 and a molecular weight of 351.63 g/mol. Its IUPAC name is N-(5-chloro-2-methoxyphenyl)-3-(diaminomethylideneamino)propanamide;hydrobromide.
| Compound Name | N-(5-chloro-2-methoxyphenyl)-3-(diaminomethylideneamino)propanamide;hydrobromide |
|---|---|
| PubChem CID | 131958555 |
| Molecular Formula | C11H16BrClN4O2 |
| Molecular Weight | 351.63 g/mol |
| Exact Mass | 350.01 |
| IUPAC Name | N-(5-chloro-2-methoxyphenyl)-3-(diaminomethylideneamino)propanamide;hydrobromide |
| SMILES | Br.COc1ccc(Cl)cc1NC(=O)CCN=C(N)N |
| InChI | InChI=1S/C11H15ClN4O2.BrH/c1-18-9-3-2-7(12)6-8(9)16-10(17)4-5-15-11(13)14;/h2-3,6H,4-5H2,1H3,(H,16,17)(H4,13,14,15);1H |
| InChIKey | JRKCJYDWSPLJLU-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.63 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|