C12H18ClIN4O2 — CID 111630099
N-(4-chloro-2-methoxy-5-methylphenyl)-3-(diaminomethylideneamino)propanamide;hydroiodide (PubChem CID 111630099) has the molecular formula C12H18ClIN4O2 and a molecular weight of 412.66 g/mol. Its IUPAC name is N-(4-chloro-2-methoxy-5-methylphenyl)-3-(diaminomethylideneamino)propanamide;hydroiodide.
| Compound Name | N-(4-chloro-2-methoxy-5-methylphenyl)-3-(diaminomethylideneamino)propanamide;hydroiodide |
|---|---|
| PubChem CID | 111630099 |
| Molecular Formula | C12H18ClIN4O2 |
| Molecular Weight | 412.66 g/mol |
| Exact Mass | 412.02 |
| IUPAC Name | N-(4-chloro-2-methoxy-5-methylphenyl)-3-(diaminomethylideneamino)propanamide;hydroiodide |
| SMILES | COc1cc(Cl)c(C)cc1NC(=O)CCN=C(N)N.I |
| InChI | InChI=1S/C12H17ClN4O2.HI/c1-7-5-9(10(19-2)6-8(7)13)17-11(18)3-4-16-12(14)15;/h5-6H,3-4H2,1-2H3,(H,17,18)(H4,14,15,16);1H |
| InChIKey | CMOFNLGQOJOICW-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.66 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|