C16H15Cl2NO2S — CID 1337784
N-(5-chloro-2-methoxyphenyl)-3-(4-chlorophenyl)sulfanylpropanamide (PubChem CID 1337784) has the molecular formula C16H15Cl2NO2S and a molecular weight of 356.27 g/mol. Its IUPAC name is N-(5-chloro-2-methoxyphenyl)-3-(4-chlorophenyl)sulfanylpropanamide.
| Compound Name | N-(5-chloro-2-methoxyphenyl)-3-(4-chlorophenyl)sulfanylpropanamide |
|---|---|
| PubChem CID | 1337784 |
| Molecular Formula | C16H15Cl2NO2S |
| Molecular Weight | 356.27 g/mol |
| Exact Mass | 355.02 |
| IUPAC Name | N-(5-chloro-2-methoxyphenyl)-3-(4-chlorophenyl)sulfanylpropanamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)CCSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H15Cl2NO2S/c1-21-15-7-4-12(18)10-14(15)19-16(20)8-9-22-13-5-2-11(17)3-6-13/h2-7,10H,8-9H2,1H3,(H,19,20) |
| InChIKey | ZAYHBRFSJDLIBA-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.27 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |