C16H16ClNO3S — CID 846639
2-((4-Chlorophenyl)thio)-N-(2,5-dimethoxyphenyl)acetamide (PubChem CID 846639) has the molecular formula C16H16ClNO3S and a molecular weight of 337.80 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfanyl-N-(2,5-dimethoxyphenyl)acetamide.
| Compound Name | 2-((4-Chlorophenyl)thio)-N-(2,5-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 846639 |
| Molecular Formula | C16H16ClNO3S |
| Molecular Weight | 337.80 g/mol |
| Exact Mass | 337.05 |
| IUPAC Name | 2-(4-chlorophenyl)sulfanyl-N-(2,5-dimethoxyphenyl)acetamide |
| SMILES | COC1=CC(=C(C=C1)OC)NC(=O)CSC2=CC=C(C=C2)Cl |
| InChI | InChI=1S/C16H16ClNO3S/c1-20-12-5-8-15(21-2)14(9-12)18-16(19)10-22-13-6-3-11(17)4-7-13/h3-9H,10H2,1-2H3,(H,18,19) |
| InChIKey | NTXUJHDNSXDJFH-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 72.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | 350 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.80 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |