C9H12ClN5O2S — CID 4160329
1-(aminocarbamothioylamino)-3-(5-chloro-2-methoxyphenyl)urea (PubChem CID 4160329) has the molecular formula C9H12ClN5O2S and a molecular weight of 289.75 g/mol. Its IUPAC name is 1-(aminocarbamothioylamino)-3-(5-chloro-2-methoxyphenyl)urea.
| Compound Name | 1-(aminocarbamothioylamino)-3-(5-chloro-2-methoxyphenyl)urea |
|---|---|
| PubChem CID | 4160329 |
| Molecular Formula | C9H12ClN5O2S |
| Molecular Weight | 289.75 g/mol |
| Exact Mass | 289.04 |
| IUPAC Name | 1-(aminocarbamothioylamino)-3-(5-chloro-2-methoxyphenyl)urea |
| SMILES | COc1ccc(Cl)cc1NC(=O)NNC(=S)NN |
| InChI | InChI=1S/C9H12ClN5O2S/c1-17-7-3-2-5(10)4-6(7)12-8(16)14-15-9(18)13-11/h2-4H,11H2,1H3,(H2,12,14,16)(H2,13,15,18) |
| InChIKey | MFZGUQQIIBNGTC-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 100.44 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.75 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|