C15H13ClF2N4O2S — CID 17378277
1-(5-chloro-2-methoxyphenyl)-3-[(2,4-difluorophenyl)carbamothioylamino]urea (PubChem CID 17378277) has the molecular formula C15H13ClF2N4O2S and a molecular weight of 386.81 g/mol. Its IUPAC name is 1-(5-chloro-2-methoxyphenyl)-3-[(2,4-difluorophenyl)carbamothioylamino]urea.
| Compound Name | 1-(5-chloro-2-methoxyphenyl)-3-[(2,4-difluorophenyl)carbamothioylamino]urea |
|---|---|
| PubChem CID | 17378277 |
| Molecular Formula | C15H13ClF2N4O2S |
| Molecular Weight | 386.81 g/mol |
| Exact Mass | 386.04 |
| IUPAC Name | 1-(5-chloro-2-methoxyphenyl)-3-[(2,4-difluorophenyl)carbamothioylamino]urea |
| SMILES | COc1ccc(Cl)cc1NC(=O)NNC(=S)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C15H13ClF2N4O2S/c1-24-13-5-2-8(16)6-12(13)19-14(23)21-22-15(25)20-11-4-3-9(17)7-10(11)18/h2-7H,1H3,(H2,19,21,23)(H2,20,22,25) |
| InChIKey | SQMDSUMMECYEKA-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 74.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.81 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|