C12H16ClNO4 — CID 112519910
2-(5-chloro-2-methoxyanilino)-3-methoxybutanoic acid (PubChem CID 112519910) has the molecular formula C12H16ClNO4 and a molecular weight of 273.72 g/mol. Its IUPAC name is 2-(5-chloro-2-methoxyanilino)-3-methoxybutanoic acid.
| Compound Name | 2-(5-chloro-2-methoxyanilino)-3-methoxybutanoic acid |
|---|---|
| PubChem CID | 112519910 |
| Molecular Formula | C12H16ClNO4 |
| Molecular Weight | 273.72 g/mol |
| Exact Mass | 273.08 |
| IUPAC Name | 2-(5-chloro-2-methoxyanilino)-3-methoxybutanoic acid |
| SMILES | COc1ccc(Cl)cc1NC(C(=O)O)C(C)OC |
| InChI | InChI=1S/C12H16ClNO4/c1-7(17-2)11(12(15)16)14-9-6-8(13)4-5-10(9)18-3/h4-7,11,14H,1-3H3,(H,15,16) |
| InChIKey | GYKUIMAIFWXPGS-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.72 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |