C15H16ClNO3 — CID 107704980
5-[1-(5-chloro-2-methoxyanilino)ethyl]benzene-1,3-diol (PubChem CID 107704980) has the molecular formula C15H16ClNO3 and a molecular weight of 293.75 g/mol. Its IUPAC name is 5-[1-(5-chloro-2-methoxyanilino)ethyl]benzene-1,3-diol.
| Compound Name | 5-[1-(5-chloro-2-methoxyanilino)ethyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 107704980 |
| Molecular Formula | C15H16ClNO3 |
| Molecular Weight | 293.75 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | 5-[1-(5-chloro-2-methoxyanilino)ethyl]benzene-1,3-diol |
| SMILES | COc1ccc(Cl)cc1NC(C)c1cc(O)cc(O)c1 |
| InChI | InChI=1S/C15H16ClNO3/c1-9(10-5-12(18)8-13(19)6-10)17-14-7-11(16)3-4-15(14)20-2/h3-9,17-19H,1-2H3 |
| InChIKey | CLHYAPFHZOFYRU-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.75 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |