C20H20ClN5O3 — CID 22546112
methyl 2-[[5-amino-6-(5-chloro-2-methoxyanilino)pyrimidin-4-yl]-methylamino]benzoate (PubChem CID 22546112) has the molecular formula C20H20ClN5O3 and a molecular weight of 413.87 g/mol. Its IUPAC name is methyl 2-[[5-amino-6-(5-chloro-2-methoxyanilino)pyrimidin-4-yl]-methylamino]benzoate.
| Compound Name | methyl 2-[[5-amino-6-(5-chloro-2-methoxyanilino)pyrimidin-4-yl]-methylamino]benzoate |
|---|---|
| PubChem CID | 22546112 |
| Molecular Formula | C20H20ClN5O3 |
| Molecular Weight | 413.87 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | methyl 2-[[5-amino-6-(5-chloro-2-methoxyanilino)pyrimidin-4-yl]-methylamino]benzoate |
| SMILES | COC(=O)c1ccccc1N(C)c1ncnc(Nc2cc(Cl)ccc2OC)c1N |
| InChI | InChI=1S/C20H20ClN5O3/c1-26(15-7-5-4-6-13(15)20(27)29-3)19-17(22)18(23-11-24-19)25-14-10-12(21)8-9-16(14)28-2/h4-11H,22H2,1-3H3,(H,23,24,25) |
| InChIKey | KIKCNRDKVRPFEK-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 102.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.87 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |