C17H23N5O3 — CID 19154066
methyl 2-[[5-amino-6-(1-methoxypropan-2-ylamino)pyrimidin-4-yl]-methylamino]benzoate (PubChem CID 19154066) has the molecular formula C17H23N5O3 and a molecular weight of 345.40 g/mol. Its IUPAC name is methyl 2-[[5-amino-6-(1-methoxypropan-2-ylamino)pyrimidin-4-yl]-methylamino]benzoate.
| Compound Name | methyl 2-[[5-amino-6-(1-methoxypropan-2-ylamino)pyrimidin-4-yl]-methylamino]benzoate |
|---|---|
| PubChem CID | 19154066 |
| Molecular Formula | C17H23N5O3 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.18 |
| IUPAC Name | methyl 2-[[5-amino-6-(1-methoxypropan-2-ylamino)pyrimidin-4-yl]-methylamino]benzoate |
| SMILES | COCC(C)Nc1ncnc(N(C)c2ccccc2C(=O)OC)c1N |
| InChI | InChI=1S/C17H23N5O3/c1-11(9-24-3)21-15-14(18)16(20-10-19-15)22(2)13-8-6-5-7-12(13)17(23)25-4/h5-8,10-11H,9,18H2,1-4H3,(H,19,20,21) |
| InChIKey | UIFNKCDATJQQGX-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 102.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |