C19H18BrN5O2 — CID 19148093
methyl 2-[[5-amino-6-(2-bromoanilino)pyrimidin-4-yl]-methylamino]benzoate (PubChem CID 19148093) has the molecular formula C19H18BrN5O2 and a molecular weight of 428.29 g/mol. Its IUPAC name is methyl 2-[[5-amino-6-(2-bromoanilino)pyrimidin-4-yl]-methylamino]benzoate.
| Compound Name | methyl 2-[[5-amino-6-(2-bromoanilino)pyrimidin-4-yl]-methylamino]benzoate |
|---|---|
| PubChem CID | 19148093 |
| Molecular Formula | C19H18BrN5O2 |
| Molecular Weight | 428.29 g/mol |
| Exact Mass | 427.06 |
| IUPAC Name | methyl 2-[[5-amino-6-(2-bromoanilino)pyrimidin-4-yl]-methylamino]benzoate |
| SMILES | COC(=O)c1ccccc1N(C)c1ncnc(Nc2ccccc2Br)c1N |
| InChI | InChI=1S/C19H18BrN5O2/c1-25(15-10-6-3-7-12(15)19(26)27-2)18-16(21)17(22-11-23-18)24-14-9-5-4-8-13(14)20/h3-11H,21H2,1-2H3,(H,22,23,24) |
| InChIKey | AXCMQSMVXKXDNN-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.29 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |