C12H14N6O2 — CID 19146230
methyl 2-[(5-amino-6-hydrazinylpyrimidin-4-yl)amino]benzoate (PubChem CID 19146230) has the molecular formula C12H14N6O2 and a molecular weight of 274.28 g/mol. Its IUPAC name is methyl 2-[(5-amino-6-hydrazinylpyrimidin-4-yl)amino]benzoate.
| Compound Name | methyl 2-[(5-amino-6-hydrazinylpyrimidin-4-yl)amino]benzoate |
|---|---|
| PubChem CID | 19146230 |
| Molecular Formula | C12H14N6O2 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | methyl 2-[(5-amino-6-hydrazinylpyrimidin-4-yl)amino]benzoate |
| SMILES | COC(=O)c1ccccc1Nc1ncnc(NN)c1N |
| InChI | InChI=1S/C12H14N6O2/c1-20-12(19)7-4-2-3-5-8(7)17-10-9(13)11(18-14)16-6-15-10/h2-6H,13-14H2,1H3,(H2,15,16,17,18) |
| InChIKey | VJQMFHSVSYEIKN-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 128.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|