C20H21N5O2 — CID 19147874
ethyl 2-[[5-amino-6-(2-methylanilino)pyrimidin-4-yl]amino]benzoate (PubChem CID 19147874) has the molecular formula C20H21N5O2 and a molecular weight of 363.42 g/mol. Its IUPAC name is ethyl 2-[[5-amino-6-(2-methylanilino)pyrimidin-4-yl]amino]benzoate.
| Compound Name | ethyl 2-[[5-amino-6-(2-methylanilino)pyrimidin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 19147874 |
| Molecular Formula | C20H21N5O2 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | ethyl 2-[[5-amino-6-(2-methylanilino)pyrimidin-4-yl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1Nc1ncnc(Nc2ccccc2C)c1N |
| InChI | InChI=1S/C20H21N5O2/c1-3-27-20(26)14-9-5-7-11-16(14)25-19-17(21)18(22-12-23-19)24-15-10-6-4-8-13(15)2/h4-12H,3,21H2,1-2H3,(H2,22,23,24,25) |
| InChIKey | TZXRVIPQPNANGM-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |