C18H18N6O4 — CID 19152080
ethyl 2-[[5-amino-6-[2-(furan-2-carbonyl)hydrazinyl]pyrimidin-4-yl]amino]benzoate (PubChem CID 19152080) has the molecular formula C18H18N6O4 and a molecular weight of 382.38 g/mol. Its IUPAC name is ethyl 2-[[5-amino-6-[2-(furan-2-carbonyl)hydrazinyl]pyrimidin-4-yl]amino]benzoate.
| Compound Name | ethyl 2-[[5-amino-6-[2-(furan-2-carbonyl)hydrazinyl]pyrimidin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 19152080 |
| Molecular Formula | C18H18N6O4 |
| Molecular Weight | 382.38 g/mol |
| Exact Mass | 382.14 |
| IUPAC Name | ethyl 2-[[5-amino-6-[2-(furan-2-carbonyl)hydrazinyl]pyrimidin-4-yl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1Nc1ncnc(NNC(=O)c2ccco2)c1N |
| InChI | InChI=1S/C18H18N6O4/c1-2-27-18(26)11-6-3-4-7-12(11)22-15-14(19)16(21-10-20-15)23-24-17(25)13-8-5-9-28-13/h3-10H,2,19H2,1H3,(H,24,25)(H2,20,21,22,23) |
| InChIKey | NCIRDZKXHGVPSR-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 144.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.38 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|