C19H20N6O2 — CID 22545282
ethyl 2-[[5-amino-6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]amino]benzoate (PubChem CID 22545282) has the molecular formula C19H20N6O2 and a molecular weight of 364.41 g/mol. Its IUPAC name is ethyl 2-[[5-amino-6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]amino]benzoate.
| Compound Name | ethyl 2-[[5-amino-6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 22545282 |
| Molecular Formula | C19H20N6O2 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | ethyl 2-[[5-amino-6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1Nc1ncnc(Nc2cc(C)ccn2)c1N |
| InChI | InChI=1S/C19H20N6O2/c1-3-27-19(26)13-6-4-5-7-14(13)24-17-16(20)18(23-11-22-17)25-15-10-12(2)8-9-21-15/h4-11H,3,20H2,1-2H3,(H2,21,22,23,24,25) |
| InChIKey | LFSBMSUDULIMAV-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 115.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |