C25H24N6O2 — CID 19146679
ethyl 2-[[5-amino-6-(2,2-diphenylhydrazinyl)pyrimidin-4-yl]amino]benzoate (PubChem CID 19146679) has the molecular formula C25H24N6O2 and a molecular weight of 440.51 g/mol. Its IUPAC name is ethyl 2-[[5-amino-6-(2,2-diphenylhydrazinyl)pyrimidin-4-yl]amino]benzoate.
| Compound Name | ethyl 2-[[5-amino-6-(2,2-diphenylhydrazinyl)pyrimidin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 19146679 |
| Molecular Formula | C25H24N6O2 |
| Molecular Weight | 440.51 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | ethyl 2-[[5-amino-6-(2,2-diphenylhydrazinyl)pyrimidin-4-yl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1Nc1ncnc(NN(c2ccccc2)c2ccccc2)c1N |
| InChI | InChI=1S/C25H24N6O2/c1-2-33-25(32)20-15-9-10-16-21(20)29-23-22(26)24(28-17-27-23)30-31(18-11-5-3-6-12-18)19-13-7-4-8-14-19/h3-17H,2,26H2,1H3,(H2,27,28,29,30) |
| InChIKey | QVIQJNKUXNNHIP-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 105.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.51 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|