C19H21N7O2 — CID 19141549
ethyl 2-[[5-amino-6-[bis(2-cyanoethyl)amino]pyrimidin-4-yl]amino]benzoate (PubChem CID 19141549) has the molecular formula C19H21N7O2 and a molecular weight of 379.42 g/mol. Its IUPAC name is ethyl 2-[[5-amino-6-[bis(2-cyanoethyl)amino]pyrimidin-4-yl]amino]benzoate.
| Compound Name | ethyl 2-[[5-amino-6-[bis(2-cyanoethyl)amino]pyrimidin-4-yl]amino]benzoate |
|---|---|
| PubChem CID | 19141549 |
| Molecular Formula | C19H21N7O2 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | ethyl 2-[[5-amino-6-[bis(2-cyanoethyl)amino]pyrimidin-4-yl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1Nc1ncnc(N(CCC#N)CCC#N)c1N |
| InChI | InChI=1S/C19H21N7O2/c1-2-28-19(27)14-7-3-4-8-15(14)25-17-16(22)18(24-13-23-17)26(11-5-9-20)12-6-10-21/h3-4,7-8,13H,2,5-6,11-12,22H2,1H3,(H,23,24,25) |
| InChIKey | KIODQMXXAOQPBH-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 140.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |