C15H15N7 — CID 19141292
2-[[5-amino-6-(2-methylanilino)pyrimidin-4-yl]-(cyanomethyl)amino]acetonitrile (PubChem CID 19141292) has the molecular formula C15H15N7 and a molecular weight of 293.33 g/mol. Its IUPAC name is 2-[[5-amino-6-(2-methylanilino)pyrimidin-4-yl]-(cyanomethyl)amino]acetonitrile.
| Compound Name | 2-[[5-amino-6-(2-methylanilino)pyrimidin-4-yl]-(cyanomethyl)amino]acetonitrile |
|---|---|
| PubChem CID | 19141292 |
| Molecular Formula | C15H15N7 |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 2-[[5-amino-6-(2-methylanilino)pyrimidin-4-yl]-(cyanomethyl)amino]acetonitrile |
| SMILES | Cc1ccccc1Nc1ncnc(N(CC#N)CC#N)c1N |
| InChI | InChI=1S/C15H15N7/c1-11-4-2-3-5-12(11)21-14-13(18)15(20-10-19-14)22(8-6-16)9-7-17/h2-5,10H,8-9,18H2,1H3,(H,19,20,21) |
| InChIKey | JKZDQUJXDJIMLH-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 114.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|