C14H11Cl2N7 — CID 22544927
2-[[5-amino-6-(3,5-dichloroanilino)pyrimidin-4-yl]-(cyanomethyl)amino]acetonitrile (PubChem CID 22544927) has the molecular formula C14H11Cl2N7 and a molecular weight of 348.20 g/mol. Its IUPAC name is 2-[[5-amino-6-(3,5-dichloroanilino)pyrimidin-4-yl]-(cyanomethyl)amino]acetonitrile.
| Compound Name | 2-[[5-amino-6-(3,5-dichloroanilino)pyrimidin-4-yl]-(cyanomethyl)amino]acetonitrile |
|---|---|
| PubChem CID | 22544927 |
| Molecular Formula | C14H11Cl2N7 |
| Molecular Weight | 348.20 g/mol |
| Exact Mass | 347.05 |
| IUPAC Name | 2-[[5-amino-6-(3,5-dichloroanilino)pyrimidin-4-yl]-(cyanomethyl)amino]acetonitrile |
| SMILES | N#CCN(CC#N)c1ncnc(Nc2cc(Cl)cc(Cl)c2)c1N |
| InChI | InChI=1S/C14H11Cl2N7/c15-9-5-10(16)7-11(6-9)22-13-12(19)14(21-8-20-13)23(3-1-17)4-2-18/h5-8H,3-4,19H2,(H,20,21,22) |
| InChIKey | LOBMJSRGJGSNBN-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 114.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.20 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|