C14H17Cl2N5 — CID 22544891
6-N-butyl-4-N-(3,5-dichlorophenyl)pyrimidine-4,5,6-triamine (PubChem CID 22544891) has the molecular formula C14H17Cl2N5 and a molecular weight of 326.23 g/mol. Its IUPAC name is 6-N-butyl-4-N-(3,5-dichlorophenyl)pyrimidine-4,5,6-triamine.
| Compound Name | 6-N-butyl-4-N-(3,5-dichlorophenyl)pyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 22544891 |
| Molecular Formula | C14H17Cl2N5 |
| Molecular Weight | 326.23 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | 6-N-butyl-4-N-(3,5-dichlorophenyl)pyrimidine-4,5,6-triamine |
| SMILES | CCCCNc1ncnc(Nc2cc(Cl)cc(Cl)c2)c1N |
| InChI | InChI=1S/C14H17Cl2N5/c1-2-3-4-18-13-12(17)14(20-8-19-13)21-11-6-9(15)5-10(16)7-11/h5-8H,2-4,17H2,1H3,(H2,18,19,20,21) |
| InChIKey | ZNQRFYOPBMMEAO-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.23 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|