C16H22ClN5O2 — CID 19134919
6-N-butyl-4-N-(5-chloro-2,4-dimethoxyphenyl)pyrimidine-4,5,6-triamine (PubChem CID 19134919) has the molecular formula C16H22ClN5O2 and a molecular weight of 351.84 g/mol. Its IUPAC name is 6-N-butyl-4-N-(5-chloro-2,4-dimethoxyphenyl)pyrimidine-4,5,6-triamine.
| Compound Name | 6-N-butyl-4-N-(5-chloro-2,4-dimethoxyphenyl)pyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 19134919 |
| Molecular Formula | C16H22ClN5O2 |
| Molecular Weight | 351.84 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | 6-N-butyl-4-N-(5-chloro-2,4-dimethoxyphenyl)pyrimidine-4,5,6-triamine |
| SMILES | CCCCNc1ncnc(Nc2cc(Cl)c(OC)cc2OC)c1N |
| InChI | InChI=1S/C16H22ClN5O2/c1-4-5-6-19-15-14(18)16(21-9-20-15)22-11-7-10(17)12(23-2)8-13(11)24-3/h7-9H,4-6,18H2,1-3H3,(H2,19,20,21,22) |
| InChIKey | QHCKJVOWENPQOI-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.84 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|