C14H17ClN4O3 — CID 19152445
4-N-(5-chloro-2,4-dimethoxyphenyl)-6-ethoxypyrimidine-4,5-diamine (PubChem CID 19152445) has the molecular formula C14H17ClN4O3 and a molecular weight of 324.77 g/mol. Its IUPAC name is 4-N-(5-chloro-2,4-dimethoxyphenyl)-6-ethoxypyrimidine-4,5-diamine.
| Compound Name | 4-N-(5-chloro-2,4-dimethoxyphenyl)-6-ethoxypyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 19152445 |
| Molecular Formula | C14H17ClN4O3 |
| Molecular Weight | 324.77 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | 4-N-(5-chloro-2,4-dimethoxyphenyl)-6-ethoxypyrimidine-4,5-diamine |
| SMILES | CCOc1ncnc(Nc2cc(Cl)c(OC)cc2OC)c1N |
| InChI | InChI=1S/C14H17ClN4O3/c1-4-22-14-12(16)13(17-7-18-14)19-9-5-8(15)10(20-2)6-11(9)21-3/h5-7H,4,16H2,1-3H3,(H,17,18,19) |
| InChIKey | NPLLOYZDLVQDOZ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 91.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.77 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |