C15H20ClN5 — CID 19134877
6-N-butyl-4-N-[(4-chlorophenyl)methyl]pyrimidine-4,5,6-triamine (PubChem CID 19134877) has the molecular formula C15H20ClN5 and a molecular weight of 305.81 g/mol. Its IUPAC name is 6-N-butyl-4-N-[(4-chlorophenyl)methyl]pyrimidine-4,5,6-triamine.
| Compound Name | 6-N-butyl-4-N-[(4-chlorophenyl)methyl]pyrimidine-4,5,6-triamine |
|---|---|
| PubChem CID | 19134877 |
| Molecular Formula | C15H20ClN5 |
| Molecular Weight | 305.81 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 6-N-butyl-4-N-[(4-chlorophenyl)methyl]pyrimidine-4,5,6-triamine |
| SMILES | CCCCNc1ncnc(NCc2ccc(Cl)cc2)c1N |
| InChI | InChI=1S/C15H20ClN5/c1-2-3-8-18-14-13(17)15(21-10-20-14)19-9-11-4-6-12(16)7-5-11/h4-7,10H,2-3,8-9,17H2,1H3,(H2,18,19,20,21) |
| InChIKey | JSTCFLRMVLZLIC-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 75.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.81 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|