C13H17ClN6 — CID 19145582
4-N-[(4-chlorophenyl)methyl]-6-(2,2-dimethylhydrazinyl)pyrimidine-4,5-diamine (PubChem CID 19145582) has the molecular formula C13H17ClN6 and a molecular weight of 292.77 g/mol. Its IUPAC name is 4-N-[(4-chlorophenyl)methyl]-6-(2,2-dimethylhydrazinyl)pyrimidine-4,5-diamine.
| Compound Name | 4-N-[(4-chlorophenyl)methyl]-6-(2,2-dimethylhydrazinyl)pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 19145582 |
| Molecular Formula | C13H17ClN6 |
| Molecular Weight | 292.77 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 4-N-[(4-chlorophenyl)methyl]-6-(2,2-dimethylhydrazinyl)pyrimidine-4,5-diamine |
| SMILES | CN(C)Nc1ncnc(NCc2ccc(Cl)cc2)c1N |
| InChI | InChI=1S/C13H17ClN6/c1-20(2)19-13-11(15)12(17-8-18-13)16-7-9-3-5-10(14)6-4-9/h3-6,8H,7,15H2,1-2H3,(H2,16,17,18,19) |
| InChIKey | NQTGZGRNBBXPSQ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 79.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.77 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|