C8H17N7 — CID 19145537
4,6-bis(2,2-dimethylhydrazinyl)pyrimidin-5-amine (PubChem CID 19145537) has the molecular formula C8H17N7 and a molecular weight of 211.27 g/mol. Its IUPAC name is 4,6-bis(2,2-dimethylhydrazinyl)pyrimidin-5-amine.
| Compound Name | 4,6-bis(2,2-dimethylhydrazinyl)pyrimidin-5-amine |
|---|---|
| PubChem CID | 19145537 |
| Molecular Formula | C8H17N7 |
| Molecular Weight | 211.27 g/mol |
| Exact Mass | 211.15 |
| IUPAC Name | 4,6-bis(2,2-dimethylhydrazinyl)pyrimidin-5-amine |
| SMILES | CN(C)Nc1ncnc(NN(C)C)c1N |
| InChI | InChI=1S/C8H17N7/c1-14(2)12-7-6(9)8(11-5-10-7)13-15(3)4/h5H,9H2,1-4H3,(H2,10,11,12,13) |
| InChIKey | LQMOBNFEMLWKFU-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 82.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.27 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|