C13H15N7S — CID 19145540
4-N-(1,3-benzothiazol-2-yl)-6-(2,2-dimethylhydrazinyl)pyrimidine-4,5-diamine (PubChem CID 19145540) has the molecular formula C13H15N7S and a molecular weight of 301.38 g/mol. Its IUPAC name is 4-N-(1,3-benzothiazol-2-yl)-6-(2,2-dimethylhydrazinyl)pyrimidine-4,5-diamine.
| Compound Name | 4-N-(1,3-benzothiazol-2-yl)-6-(2,2-dimethylhydrazinyl)pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 19145540 |
| Molecular Formula | C13H15N7S |
| Molecular Weight | 301.38 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | 4-N-(1,3-benzothiazol-2-yl)-6-(2,2-dimethylhydrazinyl)pyrimidine-4,5-diamine |
| SMILES | CN(C)Nc1ncnc(Nc2nc3ccccc3s2)c1N |
| InChI | InChI=1S/C13H15N7S/c1-20(2)19-12-10(14)11(15-7-16-12)18-13-17-8-5-3-4-6-9(8)21-13/h3-7H,14H2,1-2H3,(H2,15,16,17,18,19) |
| InChIKey | CLFZVODLHQOBKF-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 91.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.38 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|