C18H14BrN7OS — CID 19145981
N'-[5-amino-6-(1,3-benzothiazol-2-ylamino)pyrimidin-4-yl]-4-bromobenzohydrazide (PubChem CID 19145981) has the molecular formula C18H14BrN7OS and a molecular weight of 456.33 g/mol. Its IUPAC name is N'-[5-amino-6-(1,3-benzothiazol-2-ylamino)pyrimidin-4-yl]-4-bromobenzohydrazide.
| Compound Name | N'-[5-amino-6-(1,3-benzothiazol-2-ylamino)pyrimidin-4-yl]-4-bromobenzohydrazide |
|---|---|
| PubChem CID | 19145981 |
| Molecular Formula | C18H14BrN7OS |
| Molecular Weight | 456.33 g/mol |
| Exact Mass | 455.02 |
| IUPAC Name | N'-[5-amino-6-(1,3-benzothiazol-2-ylamino)pyrimidin-4-yl]-4-bromobenzohydrazide |
| SMILES | Nc1c(NNC(=O)c2ccc(Br)cc2)ncnc1Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C18H14BrN7OS/c19-11-7-5-10(6-8-11)17(27)26-25-16-14(20)15(21-9-22-16)24-18-23-12-3-1-2-4-13(12)28-18/h1-9H,20H2,(H,26,27)(H2,21,22,23,24,25) |
| InChIKey | HRRMICZHOYCKOL-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 117.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.33 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|