C15H19N7S — CID 19146005
4-N-(1,3-benzothiazol-2-yl)-6-(2-tert-butylhydrazinyl)pyrimidine-4,5-diamine (PubChem CID 19146005) has the molecular formula C15H19N7S and a molecular weight of 329.43 g/mol. Its IUPAC name is 4-N-(1,3-benzothiazol-2-yl)-6-(2-tert-butylhydrazinyl)pyrimidine-4,5-diamine.
| Compound Name | 4-N-(1,3-benzothiazol-2-yl)-6-(2-tert-butylhydrazinyl)pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 19146005 |
| Molecular Formula | C15H19N7S |
| Molecular Weight | 329.43 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 4-N-(1,3-benzothiazol-2-yl)-6-(2-tert-butylhydrazinyl)pyrimidine-4,5-diamine |
| SMILES | CC(C)(C)NNc1ncnc(Nc2nc3ccccc3s2)c1N |
| InChI | InChI=1S/C15H19N7S/c1-15(2,3)22-21-13-11(16)12(17-8-18-13)20-14-19-9-6-4-5-7-10(9)23-14/h4-8,22H,16H2,1-3H3,(H2,17,18,19,20,21) |
| InChIKey | VFBCSWUIZSCJCR-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.43 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|