C16H21N7S — CID 19150109
6-(2-tert-butylhydrazinyl)-4-N-(6-methyl-1,3-benzothiazol-2-yl)pyrimidine-4,5-diamine (PubChem CID 19150109) has the molecular formula C16H21N7S and a molecular weight of 343.46 g/mol. Its IUPAC name is 6-(2-tert-butylhydrazinyl)-4-N-(6-methyl-1,3-benzothiazol-2-yl)pyrimidine-4,5-diamine.
| Compound Name | 6-(2-tert-butylhydrazinyl)-4-N-(6-methyl-1,3-benzothiazol-2-yl)pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 19150109 |
| Molecular Formula | C16H21N7S |
| Molecular Weight | 343.46 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 6-(2-tert-butylhydrazinyl)-4-N-(6-methyl-1,3-benzothiazol-2-yl)pyrimidine-4,5-diamine |
| SMILES | Cc1ccc2nc(Nc3ncnc(NNC(C)(C)C)c3N)sc2c1 |
| InChI | InChI=1S/C16H21N7S/c1-9-5-6-10-11(7-9)24-15(20-10)21-13-12(17)14(19-8-18-13)22-23-16(2,3)4/h5-8,23H,17H2,1-4H3,(H2,18,19,20,21,22) |
| InChIKey | MONHMCNUOHCQGP-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.46 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|