C19H16ClN7OS — CID 19150084
N'-[5-amino-6-[(6-methyl-1,3-benzothiazol-2-yl)amino]pyrimidin-4-yl]-4-chlorobenzohydrazide (PubChem CID 19150084) has the molecular formula C19H16ClN7OS and a molecular weight of 425.91 g/mol. Its IUPAC name is N'-[5-amino-6-[(6-methyl-1,3-benzothiazol-2-yl)amino]pyrimidin-4-yl]-4-chlorobenzohydrazide.
| Compound Name | N'-[5-amino-6-[(6-methyl-1,3-benzothiazol-2-yl)amino]pyrimidin-4-yl]-4-chlorobenzohydrazide |
|---|---|
| PubChem CID | 19150084 |
| Molecular Formula | C19H16ClN7OS |
| Molecular Weight | 425.91 g/mol |
| Exact Mass | 425.08 |
| IUPAC Name | N'-[5-amino-6-[(6-methyl-1,3-benzothiazol-2-yl)amino]pyrimidin-4-yl]-4-chlorobenzohydrazide |
| SMILES | Cc1ccc2nc(Nc3ncnc(NNC(=O)c4ccc(Cl)cc4)c3N)sc2c1 |
| InChI | InChI=1S/C19H16ClN7OS/c1-10-2-7-13-14(8-10)29-19(24-13)25-16-15(21)17(23-9-22-16)26-27-18(28)11-3-5-12(20)6-4-11/h2-9H,21H2,1H3,(H,27,28)(H2,22,23,24,25,26) |
| InChIKey | AZEASZPPDBTCJL-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 117.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.91 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|