C18H16ClFN6O — CID 19150738
N'-[5-amino-6-(3-chloro-4-fluoroanilino)pyrimidin-4-yl]-4-methylbenzohydrazide (PubChem CID 19150738) has the molecular formula C18H16ClFN6O and a molecular weight of 386.82 g/mol. Its IUPAC name is N'-[5-amino-6-(3-chloro-4-fluoroanilino)pyrimidin-4-yl]-4-methylbenzohydrazide.
| Compound Name | N'-[5-amino-6-(3-chloro-4-fluoroanilino)pyrimidin-4-yl]-4-methylbenzohydrazide |
|---|---|
| PubChem CID | 19150738 |
| Molecular Formula | C18H16ClFN6O |
| Molecular Weight | 386.82 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | N'-[5-amino-6-(3-chloro-4-fluoroanilino)pyrimidin-4-yl]-4-methylbenzohydrazide |
| SMILES | Cc1ccc(C(=O)NNc2ncnc(Nc3ccc(F)c(Cl)c3)c2N)cc1 |
| InChI | InChI=1S/C18H16ClFN6O/c1-10-2-4-11(5-3-10)18(27)26-25-17-15(21)16(22-9-23-17)24-12-6-7-14(20)13(19)8-12/h2-9H,21H2,1H3,(H,26,27)(H2,22,23,24,25) |
| InChIKey | UEZZSMOHVYIUKZ-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 104.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.82 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|