C21H19ClN6O5 — CID 22547683
dimethyl 5-[[5-amino-6-[2-(4-chlorobenzoyl)hydrazinyl]pyrimidin-4-yl]amino]benzene-1,3-dicarboxylate (PubChem CID 22547683) has the molecular formula C21H19ClN6O5 and a molecular weight of 470.87 g/mol. Its IUPAC name is dimethyl 5-[[5-amino-6-[2-(4-chlorobenzoyl)hydrazinyl]pyrimidin-4-yl]amino]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[[5-amino-6-[2-(4-chlorobenzoyl)hydrazinyl]pyrimidin-4-yl]amino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 22547683 |
| Molecular Formula | C21H19ClN6O5 |
| Molecular Weight | 470.87 g/mol |
| Exact Mass | 470.11 |
| IUPAC Name | dimethyl 5-[[5-amino-6-[2-(4-chlorobenzoyl)hydrazinyl]pyrimidin-4-yl]amino]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(Nc2ncnc(NNC(=O)c3ccc(Cl)cc3)c2N)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C21H19ClN6O5/c1-32-20(30)12-7-13(21(31)33-2)9-15(8-12)26-17-16(23)18(25-10-24-17)27-28-19(29)11-3-5-14(22)6-4-11/h3-10H,23H2,1-2H3,(H,28,29)(H2,24,25,26,27) |
| InChIKey | CWBACFRSBMXQOQ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 157.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.87 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|