C21H16Cl2N6O7 — CID 23486379
dimethyl 5-[[6-[2-(2,4-dichlorobenzoyl)hydrazinyl]-5-nitropyrimidin-4-yl]amino]benzene-1,3-dicarboxylate (PubChem CID 23486379) has the molecular formula C21H16Cl2N6O7 and a molecular weight of 535.30 g/mol. Its IUPAC name is dimethyl 5-[[6-[2-(2,4-dichlorobenzoyl)hydrazinyl]-5-nitropyrimidin-4-yl]amino]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[[6-[2-(2,4-dichlorobenzoyl)hydrazinyl]-5-nitropyrimidin-4-yl]amino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 23486379 |
| Molecular Formula | C21H16Cl2N6O7 |
| Molecular Weight | 535.30 g/mol |
| Exact Mass | 534.05 |
| IUPAC Name | dimethyl 5-[[6-[2-(2,4-dichlorobenzoyl)hydrazinyl]-5-nitropyrimidin-4-yl]amino]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(Nc2ncnc(NNC(=O)c3ccc(Cl)cc3Cl)c2[N+](=O)[O-])cc(C(=O)OC)c1 |
| InChI | InChI=1S/C21H16Cl2N6O7/c1-35-20(31)10-5-11(21(32)36-2)7-13(6-10)26-17-16(29(33)34)18(25-9-24-17)27-28-19(30)14-4-3-12(22)8-15(14)23/h3-9H,1-2H3,(H,28,30)(H2,24,25,26,27) |
| InChIKey | MYEGVHLQBTYPAL-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 174.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.30 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|