C11H9Cl2N7O3 — CID 22534722
2,4-dichloro-N'-(6-hydrazinyl-5-nitropyrimidin-4-yl)benzohydrazide (PubChem CID 22534722) has the molecular formula C11H9Cl2N7O3 and a molecular weight of 358.15 g/mol. Its IUPAC name is 2,4-dichloro-N'-(6-hydrazinyl-5-nitropyrimidin-4-yl)benzohydrazide.
| Compound Name | 2,4-dichloro-N'-(6-hydrazinyl-5-nitropyrimidin-4-yl)benzohydrazide |
|---|---|
| PubChem CID | 22534722 |
| Molecular Formula | C11H9Cl2N7O3 |
| Molecular Weight | 358.15 g/mol |
| Exact Mass | 357.01 |
| IUPAC Name | 2,4-dichloro-N'-(6-hydrazinyl-5-nitropyrimidin-4-yl)benzohydrazide |
| SMILES | NNc1ncnc(NNC(=O)c2ccc(Cl)cc2Cl)c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H9Cl2N7O3/c12-5-1-2-6(7(13)3-5)11(21)19-18-10-8(20(22)23)9(17-14)15-4-16-10/h1-4H,14H2,(H,19,21)(H2,15,16,17,18) |
| InChIKey | HEFFHJPMEGDKPI-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 148.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.15 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|