C16H16Cl2N6O4 — CID 23481588
2,4-dichloro-N'-[5-nitro-6-(oxolan-2-ylmethylamino)pyrimidin-4-yl]benzohydrazide (PubChem CID 23481588) has the molecular formula C16H16Cl2N6O4 and a molecular weight of 427.25 g/mol. Its IUPAC name is 2,4-dichloro-N'-[5-nitro-6-(oxolan-2-ylmethylamino)pyrimidin-4-yl]benzohydrazide.
| Compound Name | 2,4-dichloro-N'-[5-nitro-6-(oxolan-2-ylmethylamino)pyrimidin-4-yl]benzohydrazide |
|---|---|
| PubChem CID | 23481588 |
| Molecular Formula | C16H16Cl2N6O4 |
| Molecular Weight | 427.25 g/mol |
| Exact Mass | 426.06 |
| IUPAC Name | 2,4-dichloro-N'-[5-nitro-6-(oxolan-2-ylmethylamino)pyrimidin-4-yl]benzohydrazide |
| SMILES | O=C(NNc1ncnc(NCC2CCCO2)c1[N+](=O)[O-])c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H16Cl2N6O4/c17-9-3-4-11(12(18)6-9)16(25)23-22-15-13(24(26)27)14(20-8-21-15)19-7-10-2-1-5-28-10/h3-4,6,8,10H,1-2,5,7H2,(H,23,25)(H2,19,20,21,22) |
| InChIKey | UTINNHRAYXHNCX-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 131.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.25 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|