C16H18Cl2N6O2 — CID 22543062
N'-[5-amino-6-(oxolan-2-ylmethylamino)pyrimidin-4-yl]-2,4-dichlorobenzohydrazide (PubChem CID 22543062) has the molecular formula C16H18Cl2N6O2 and a molecular weight of 397.27 g/mol. Its IUPAC name is N'-[5-amino-6-(oxolan-2-ylmethylamino)pyrimidin-4-yl]-2,4-dichlorobenzohydrazide.
| Compound Name | N'-[5-amino-6-(oxolan-2-ylmethylamino)pyrimidin-4-yl]-2,4-dichlorobenzohydrazide |
|---|---|
| PubChem CID | 22543062 |
| Molecular Formula | C16H18Cl2N6O2 |
| Molecular Weight | 397.27 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | N'-[5-amino-6-(oxolan-2-ylmethylamino)pyrimidin-4-yl]-2,4-dichlorobenzohydrazide |
| SMILES | Nc1c(NCC2CCCO2)ncnc1NNC(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H18Cl2N6O2/c17-9-3-4-11(12(18)6-9)16(25)24-23-15-13(19)14(21-8-22-15)20-7-10-2-1-5-26-10/h3-4,6,8,10H,1-2,5,7,19H2,(H,24,25)(H2,20,21,22,23) |
| InChIKey | BHIMLPULRCXHCE-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 114.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.27 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|