C15H18Cl2N6O2 — CID 19151719
N'-[5-amino-6-(1-methoxypropan-2-ylamino)pyrimidin-4-yl]-2,4-dichlorobenzohydrazide (PubChem CID 19151719) has the molecular formula C15H18Cl2N6O2 and a molecular weight of 385.26 g/mol. Its IUPAC name is N'-[5-amino-6-(1-methoxypropan-2-ylamino)pyrimidin-4-yl]-2,4-dichlorobenzohydrazide.
| Compound Name | N'-[5-amino-6-(1-methoxypropan-2-ylamino)pyrimidin-4-yl]-2,4-dichlorobenzohydrazide |
|---|---|
| PubChem CID | 19151719 |
| Molecular Formula | C15H18Cl2N6O2 |
| Molecular Weight | 385.26 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | N'-[5-amino-6-(1-methoxypropan-2-ylamino)pyrimidin-4-yl]-2,4-dichlorobenzohydrazide |
| SMILES | COCC(C)Nc1ncnc(NNC(=O)c2ccc(Cl)cc2Cl)c1N |
| InChI | InChI=1S/C15H18Cl2N6O2/c1-8(6-25-2)21-13-12(18)14(20-7-19-13)22-23-15(24)10-4-3-9(16)5-11(10)17/h3-5,7-8H,6,18H2,1-2H3,(H,23,24)(H2,19,20,21,22) |
| InChIKey | NLDQSEZYMFVQTE-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 114.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.26 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|