C19H18Cl2N6O2 — CID 19151724
N'-[5-amino-6-(2-ethoxyanilino)pyrimidin-4-yl]-2,4-dichlorobenzohydrazide (PubChem CID 19151724) has the molecular formula C19H18Cl2N6O2 and a molecular weight of 433.30 g/mol. Its IUPAC name is N'-[5-amino-6-(2-ethoxyanilino)pyrimidin-4-yl]-2,4-dichlorobenzohydrazide.
| Compound Name | N'-[5-amino-6-(2-ethoxyanilino)pyrimidin-4-yl]-2,4-dichlorobenzohydrazide |
|---|---|
| PubChem CID | 19151724 |
| Molecular Formula | C19H18Cl2N6O2 |
| Molecular Weight | 433.30 g/mol |
| Exact Mass | 432.09 |
| IUPAC Name | N'-[5-amino-6-(2-ethoxyanilino)pyrimidin-4-yl]-2,4-dichlorobenzohydrazide |
| SMILES | CCOc1ccccc1Nc1ncnc(NNC(=O)c2ccc(Cl)cc2Cl)c1N |
| InChI | InChI=1S/C19H18Cl2N6O2/c1-2-29-15-6-4-3-5-14(15)25-17-16(22)18(24-10-23-17)26-27-19(28)12-8-7-11(20)9-13(12)21/h3-10H,2,22H2,1H3,(H,27,28)(H2,23,24,25,26) |
| InChIKey | IEGZXQWDNOCEKM-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 114.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.30 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|