C19H19ClN6O2 — CID 19151022
N'-[5-amino-6-(2-ethoxyanilino)pyrimidin-4-yl]-4-chlorobenzohydrazide (PubChem CID 19151022) has the molecular formula C19H19ClN6O2 and a molecular weight of 398.85 g/mol. Its IUPAC name is N'-[5-amino-6-(2-ethoxyanilino)pyrimidin-4-yl]-4-chlorobenzohydrazide.
| Compound Name | N'-[5-amino-6-(2-ethoxyanilino)pyrimidin-4-yl]-4-chlorobenzohydrazide |
|---|---|
| PubChem CID | 19151022 |
| Molecular Formula | C19H19ClN6O2 |
| Molecular Weight | 398.85 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | N'-[5-amino-6-(2-ethoxyanilino)pyrimidin-4-yl]-4-chlorobenzohydrazide |
| SMILES | CCOc1ccccc1Nc1ncnc(NNC(=O)c2ccc(Cl)cc2)c1N |
| InChI | InChI=1S/C19H19ClN6O2/c1-2-28-15-6-4-3-5-14(15)24-17-16(21)18(23-11-22-17)25-26-19(27)12-7-9-13(20)10-8-12/h3-11H,2,21H2,1H3,(H,26,27)(H2,22,23,24,25) |
| InChIKey | BGHYXKHBIUAFHZ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 114.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.85 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|